For research use only. Not for therapeutic Use.
Acenocoumarol(CAT: I001900) is an anticoagulant belonging to the class of vitamin K antagonists, primarily used in cardiovascular research. It inhibits the synthesis of vitamin K-dependent clotting factors, including Factors II, VII, IX, and X, making it valuable for studying blood coagulation pathways and thrombosis. Researchers utilize Acenocoumarol to investigate therapeutic strategies for preventing and managing conditions such as deep vein thrombosis, pulmonary embolism, and atrial fibrillation. Its precise mechanism of action and pharmacokinetic profile make it an essential compound for preclinical studies focused on anticoagulation and cardiovascular disease management.
| Catalog Number | I001900 |
| CAS Number | 152-72-7 |
| Synonyms | Acenocoumarin;Nicoumalone;G-23350;Sinthrome®;Sintrom® |
| Molecular Formula | C19H15NO6 |
| Purity | ≥95% |
| Target | Vitamin K Antagonist |
| Solubility | 10 mM in H2O |
| Storage | -20°C |
| IUPAC Name | 4-hydroxy-3-[1-(4-nitrophenyl)-3-oxobutyl]chromen-2-one |
| InChI | InChI=1S/C19H15NO6/c1-11(21)10-15(12-6-8-13(9-7-12)20(24)25)17-18(22)14-4-2-3-5-16(14)26-19(17)23/h2-9,15,22H,10H2,1H3 |
| InChIKey | VABCILAOYCMVPS-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C1=CC=C(C=C1)[N+](=O)[O-])C2=C(C3=CC=CC=C3OC2=O)O |
