For research use only. Not for therapeutic Use.
Acepyrene, a synthetic organic compound, is used as a blue dye in the textile industry. It belongs to the family of pyrene dyes, known for their vivid coloration and lightfastness properties. Acepyrene finds applications in dyeing cotton, wool, and silk fabrics, providing vibrant blue hues. Additionally, it is utilized in the manufacturing of inks, coatings, and plastics due to its intense coloration.
CAS Number | 27208-37-3 |
Synonyms | Cyclopentapyrene; Acepyrylene; Cyclopenta[cd]pyrene |
Molecular Formula | C18H10 |
Purity | ≥95% |
Storage | Store at 4°C |
InChI | InChI=1S/C18H10/c1-2-11-4-6-13-7-5-12-8-9-15-10-14(3-1)16(11)18(13)17(12)15/h1-10H |
InChIKey | BZCXQYVNASLLQO-UHFFFAOYSA-N |
SMILES | C1=CC2=C3C(=C1)C=C4C=CC5=C4C3=C(C=C2)C=C5 |