For research use only. Not for therapeutic Use.
Acesulfame aspartame salt (Cat No.:R017369) is a compound that combines acesulfame potassium (a high-intensity artificial sweetener) with aspartame (another artificial sweetener). This combination is used to enhance sweetness and provide a sugar-like taste in various food and beverage products, including low-calorie and sugar-free items. Acesulfame aspartame salt offers a synergistic sweetening effect, allowing manufacturers to reduce the amount of each sweetener while maintaining the desired level of sweetness. It is a popular choice for formulating low-calorie and diet products, as it provides sweetness without contributing significant calories or affecting blood sugar levels.
CAS Number | 106372-55-8 |
Synonyms | Twinsweet; Twinsweet LA; L-α-Aspartyl-L-phenylalanine 2-Methyl Ester 6-Methyl-1,2,3-oxathiazin-4(3H)-one 2,2-dioxide; N-L-α-Aspartyl-L-phenylalanine 1-Methyl Ester With 6-Methyl-1,2,3-oxathiazin-4(3H)-one 2,2-dioxide; 6-Methyl-1,2,3-oxathiazin-4(3 |
Molecular Formula | C18H23N3O9S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid;6-methyl-2,2-dioxooxathiazin-4-one |
InChI | InChI=1S/C14H18N2O5.C4H5NO4S/c1-21-14(20)11(7-9-5-3-2-4-6-9)16-13(19)10(15)8-12(17)18;1-3-2-4(6)5-10(7,8)9-3/h2-6,10-11H,7-8,15H2,1H3,(H,16,19)(H,17,18);2H,1H3,(H,5,6)/t10-,11-;/m0./s1 |
InChIKey | KVHQNWGLVVERFR-ACMTZBLWSA-N |
SMILES | CC1=CC(=O)NS(=O)(=O)O1.COC(=O)C(CC1=CC=CC=C1)NC(=O)C(CC(=O)O)N |
Reference | <p> |