For research use only. Not for therapeutic Use.
Acetal (Cat No.:M067163) is a chemical compound classified as a functional group derived from aldehydes and ketones. It is commonly used as a protecting group in organic synthesis to temporarily block reactive carbonyl groups, allowing selective transformations without affecting the desired molecules. Acetals are formed by reacting aldehydes or ketones with alcohols under acidic conditions. They are stable under mild conditions but can be easily cleaved back to the original carbonyl compounds using acid or base catalysis.
CAS Number | 105-57-7 |
Molecular Formula | C6H14O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1,1-diethoxyethane |
InChI | InChI=1S/C6H14O2/c1-4-7-6(3)8-5-2/h6H,4-5H2,1-3H3 |
InChIKey | DHKHKXVYLBGOIT-UHFFFAOYSA-N |
SMILES | CCOC(C)OCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |