For research use only, not for therapeutic use.
Acetamide-2,2,2-d3 (Cat No.:C000903) is an isotopically labeled organic compound. It is a colorless to pale yellow solid and belongs to the family of deuterated acetamides. This compound is used as a stable isotope-labeled internal standard in various analytical and research applications. The presence of deuterium atoms in place of hydrogen atoms in the molecule allows for accurate quantification and identification in mass spectrometry and nuclear magnetic resonance (NMR) experiments.
| Catalog Number | C000903 |
| CAS Number | 23724-60-9 |
| Synonyms | 2,2,2-Trideuteroacetamide |
| Molecular Formula | C₂H₂D₃NO |
| Purity | ≥95% |
| Solubility | DMSO (Soluble), Methanol (Slightly), Water (Sparingly) |
| Appearance | White to Off-White Solid |
| Storage | RT |
| IUPAC Name | 2,2,2-trideuterioacetamide |
| InChI | InChI=1S/C2H5NO/c1-2(3)4/h1H3,(H2,3,4)/i1D3 |
| InChIKey | DLFVBJFMPXGRIB-FIBGUPNXSA-N |
| SMILES | CC(=O)N |
| Reference | Suzuki, I., et al.: Bull. Chem. Soc. of Jpn., 35, 1279 (1962); Knudsen, R., et al.: J. Mol. Struct., 321, 187 (1994) |
