For research use only. Not for therapeutic Use.
Acetaminophen Acetate (Cat.No:R009414) is an impurity of acetaminophen (paracetamol), a widely used over-the-counter pain reliever and fever reducer. It forms during the synthesis or storage of acetaminophen and is considered an unwanted byproduct. Monitoring and controlling the levels of such impurities are crucial to ensure the quality and safety of pharmaceutical formulations.
| Catalog Number | R009414 |
| CAS Number | 2623-33-8 |
| Synonyms | N-[4-(Acetyloxy)phenyl]acetamide; 4’-Hydroxyacetanilide Acetate; 4’-Acetoxyacetanilide; 4-Acetamidophenyl Acetate; O-Acetylparacetamol; p-Acetamidophenyl Acetate; p-Acetoxyacetanilide; NSC 33893; NSC 6083; Acetaminophen Impurity; Acetaminophen Relate |
| Molecular Formula | C10H11NO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (4-acetamidophenyl) acetate |
| InChI | InChI=1S/C10H11NO3/c1-7(12)11-9-3-5-10(6-4-9)14-8(2)13/h3-6H,1-2H3,(H,11,12) |
| InChIKey | UJAOSPFULOFZRR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)OC(=O)C |
