For research use only. Not for therapeutic Use.
Acetazolamide sodium(Cat No.:M048257)is a carbonic anhydrase inhibitor used primarily to treat conditions like glaucoma, altitude sickness, epilepsy, and certain types of edema. By inhibiting carbonic anhydrase, it reduces the production of aqueous humor in the eye, lowering intraocular pressure, and promotes bicarbonate excretion, leading to diuresis. Acetazolamide sodium is also used to correct metabolic alkalosis and as an adjunct therapy for some seizure disorders. Its ability to regulate fluid and electrolyte balance makes it valuable in managing a range of medical conditions, including high-altitude sickness and drug-induced edema.
CAS Number | 1424-27-7 |
Molecular Formula | C4H5N4NaO3S2 |
Purity | ≥95% |
Target | Autophagy |
Storage | Desiccate at +4C |
IUPAC Name | sodium;(5-acetamido-1,3,4-thiadiazol-2-yl)sulfonylazanide |
InChI | InChI=1S/C4H6N4O3S2.Na/c1-2(9)6-3-7-8-4(12-3)13(5,10)11;/h1H3,(H3,5,6,7,9,10,11);/q;+1/p-1 |
InChIKey | MRSXAJAOWWFZJJ-UHFFFAOYSA-M |
SMILES | CC(=O)NC1=NN=C(S1)S(=O)(=O)[NH-].[Na+] |