For research use only. Not for therapeutic Use.
Acetic-1-13C Acid (Cat No.:M047983) is an isotopically labeled form of acetic acid. It contains a stable carbon-13 isotope at the carbon-1 position of the acetic acid molecule. Isotopically labeled compounds like acetic-1-13C acid are valuable tools in various fields of research, including drug metabolism studies, metabolic pathway analysis, and NMR spectroscopy. By incorporating specific isotopes into molecules, researchers can trace the fate of compounds within biological systems or study the structure and behavior of molecules using advanced spectroscopic techniques, providing insights into chemical processes and interactions.
CAS Number | 1563-79-7 |
Molecular Formula | C2H4O2 |
Purity | ≥95% |
Storage | Desiccate at +4°C |
IUPAC Name | acetic acid |
InChI | InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i2+1 |
InChIKey | QTBSBXVTEAMEQO-VQEHIDDOSA-N |
SMILES | CC(=O)O |