For research use only. Not for therapeutic Use.
Acetic-18O 2 acid(Cat No.:M075967), also known as acetic acid-18O 2 or acetic acid-d2, is a chemical compound derived from acetic acid (CH3COOH) in which the oxygen atom (O) in the carboxyl group is replaced with the isotopic variant oxygen-18 (18O). This isotopic substitution results in acetic acid with enhanced stability and unique spectroscopic properties, making it valuable in various scientific applications such as nuclear magnetic resonance (NMR) spectroscopy and isotope labeling studies. Acetic-18O 2 acid serves as a labeled precursor in organic synthesis and biochemical research, facilitating the elucidation of chemical and metabolic pathways.
Catalog Number | M075967 |
CAS Number | 17217-83-3 |
Molecular Formula | C2H4O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | acetic acid |
InChI | InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i3+2,4+2 |
InChIKey | QTBSBXVTEAMEQO-NUQCWPJISA-N |
SMILES | CC(=O)O |