For research use only. Not for therapeutic Use.
Acetic acid, 2-[2-[2-(2-propyn-1-yloxy)ethoxy]ethoxy](CAT: L009393), also known as a triple-ether acetic acid, is a valuable chemical intermediate with diverse applications. In organic synthesis, it serves as a linker or protecting group, enabling the construction of complex molecules. In pharmaceutical research, it can be employed to modify drug candidates, influencing solubility, bioavailability, or targeting. Additionally, its propyn-1-yloxy moiety has potential in material chemistry for designing functionalized polymers or surfaces, contributing to drug delivery systems or biomaterials. Its versatile nature makes it a crucial tool in various fields, facilitating the creation of innovative compounds with tailored properties.
CAS Number | 944561-46-0 |
Molecular Formula | C9H14O5 |
Purity | ≥95% |
Target | PROTAC Linkers |
IUPAC Name | 2-[2-(2-prop-2-ynoxyethoxy)ethoxy]acetic acid |
InChI | InChI=1S/C9H14O5/c1-2-3-12-4-5-13-6-7-14-8-9(10)11/h1H,3-8H2,(H,10,11) |
InChIKey | FWONAGPFSKACQC-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |