For research use only. Not for therapeutic Use.
Acetic acid, a colorless liquid with a pungent odor, is a key component of vinegar, comprising about 4-8% of its content. It has the chemical formula CH₃COOH and is widely used in food preservation, flavoring, and as a culinary ingredient. Industrially, acetic acid is produced through the carbonylation of methanol and serves as a precursor for various chemicals, including acetates and plastics. Its versatility extends to pharmaceuticals and cleaning agents, making it an essential compound in multiple sectors.
| Catalog Number | R020204 |
| CAS Number | 64-19-7 |
| Synonyms | Aci-Jel; E 260; Ethanoic Acid; Ethanoic Acid Monomer; Ethylic Acid; Glacial Acetic Acid; Methanecarboxylic Acid; NSC 111201; NSC 112209; NSC 115870; NSC 127175; NSC 132953; NSC 406306; Vinegar Acid |
| Molecular Formula | C2H4O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | acetic acid |
| InChI | InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4) |
| InChIKey | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| SMILES | CC(=O)O |
