For research use only. Not for therapeutic Use.
Acetoacetic Acid Lithium Salt(CAT: I018182) is a stable lithium salt of acetoacetic acid, commonly used as a biochemical reagent and intermediate in organic synthesis. It plays a significant role in metabolic research, particularly in studying ketogenesis and energy metabolism. As a ketone body precursor, it helps investigate metabolic pathways involved in conditions like diabetes, obesity, and metabolic disorders. Its stability and solubility make it a valuable tool for enzymatic studies, biomarker analysis, and pharmaceutical applications, supporting advancements in understanding energy homeostasis and metabolic regulation.
Catalog Number | I018182 |
CAS Number | 3483-11-2 |
Molecular Formula | C₄H₅LiO₃ |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | lithium;3-oxobutanoate |
InChI | InChI=1S/C4H6O3.Li/c1-3(5)2-4(6)7;/h2H2,1H3,(H,6,7);/q;+1/p-1 |
InChIKey | UTLRZTUJSMCBHB-UHFFFAOYSA-M |
SMILES | [Li+].CC(=O)CC(=O)[O-] |