For research use only. Not for therapeutic Use.
Acetoacetic acid sec-butyl ester(Cat No.:M062857), also known as sec-butyl acetoacetate, is a chemical compound with the formula C8H14O3. It is an ester derived from acetoacetic acid and sec-butanol. This compound is utilized primarily as a synthetic intermediate in organic chemistry and is valuable in the production of dyes, pharmaceuticals, and fragrances. It serves as a precursor in various synthesis processes due to its ability to undergo transformations that introduce complex functionalities. Additionally, acetoacetic acid sec-butyl ester is used in the synthesis of pyrazole derivatives, which are significant in pharmaceutical applications.
Catalog Number | M062857 |
CAS Number | 13562-76-0 |
Molecular Formula | C8H14O3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | butan-2-yl 3-oxobutanoate |
InChI | InChI=1S/C8H14O3/c1-4-7(3)11-8(10)5-6(2)9/h7H,4-5H2,1-3H3 |
InChIKey | QSTNBMLCULGCQE-UHFFFAOYSA-N |
SMILES | CCC(C)OC(=O)CC(=O)C |