For research use only. Not for therapeutic Use.
Acetochlor is a pre-emergent herbicide widely used in agriculture to control annual grasses and broadleaf weeds in crops like corn and soybeans. Its mode of action involves inhibiting cell division in germinating seeds, effectively preventing weed growth. Acetochlor’s efficacy and selectivity make it a valuable tool for farmers, helping to increase crop yields and reduce competition from unwanted vegetation.
| Catalog Number | R031420 |
| CAS Number | 34256-82-1 |
| Synonyms | 2-Chloro-N-(ethoxy-methyl)-N-(2-ethyl-6-methylphenyl)acetamide; 2’-Ethyl-6’-methyl-N-(ethoxymethyl)-2-chloroacetanilide; Acenit; Acetal; Acetal (herbicide); Acetochlor; Azetochlor; Guardian; Guardian (herbicide); Harness; Henaisi; MG 02; MON 097; Nev |
| Molecular Formula | C14H20ClNO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide |
| InChI | InChI=1S/C14H20ClNO2/c1-4-12-8-6-7-11(3)14(12)16(10-18-5-2)13(17)9-15/h6-8H,4-5,9-10H2,1-3H3 |
| InChIKey | VTNQPKFIQCLBDU-UHFFFAOYSA-N |
| SMILES | CCC1=CC=CC(=C1N(COCC)C(=O)CCl)C |
