For research use only. Not for therapeutic Use.
Acetoin acetate(Cat No.:L015198)is an organic compound formed by the esterification of acetoin, a naturally occurring keto alcohol, with acetic acid. It is used in the flavor and fragrance industries due to its pleasant, buttery aroma, often found in baked goods, dairy products, and other food items. Acetoin acetate is also utilized in various chemical synthesis processes as an intermediate. Its dual functional groups—a ketone and an ester—allow it to participate in multiple reactions, making it a versatile compound in both flavor formulation and organic chemistry.
CAS Number | 4906-24-5 |
Molecular Formula | C6H10O3 |
Purity | ≥95% |
IUPAC Name | 3-oxobutan-2-yl acetate |
InChI | InChI=1S/C6H10O3/c1-4(7)5(2)9-6(3)8/h5H,1-3H3 |
InChIKey | ZKPTYCJWRHHBOW-UHFFFAOYSA-N |
SMILES | CC(C(=O)C)OC(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |