For research use only. Not for therapeutic Use.
Acetone Azine (Cat.No:R032492) is a chemical compound utilized in organic synthesis. It serves as a versatile reagent, particularly in the formation of hydrazones and other nitrogen-containing compounds. Acetone Azine’s unique structure and reactivity make it valuable in the preparation of diverse molecules for research and industrial applications.
| Catalog Number | R032492 |
| CAS Number | 627-70-3 |
| Synonyms | Acetazine; Acetone Ketazine; Dimethyl Ketazine; NSC 170328; NSC 52680 |
| Molecular Formula | C6H12N2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N-(propan-2-ylideneamino)propan-2-imine |
| InChI | InChI=1S/C6H12N2/c1-5(2)7-8-6(3)4/h1-4H3 |
| InChIKey | PFLUPZGCTVGDLV-UHFFFAOYSA-N |
| SMILES | CC(=NN=C(C)C)C |
