For research use only. Not for therapeutic Use.
Acetrizoic acid (Cat.No:I005124) is a radiocontrast agent used in medical imaging procedures such as X-rays, CT scans, and angiography. It is a highly water-soluble iodinated organic compound with a triiodinated benzene ring structure. Acetrizoic acid is injected into the bloodstream to enhance the contrast of blood vessels and organs, allowing for better visualization of internal structures during diagnostic imaging.
| Catalog Number | I005124 |
| CAS Number | 85-36-9 |
| Molecular Formula | C9H6I3NO3 |
| Purity | ≥95% |
| Solubility | DMSO: ≥ 5.6 mg/mL, H2O: ＜ 5.6 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 3-acetamido-2,4,6-triiodobenzoic acid |
| InChI | InChI=1S/C9H6I3NO3/c1-3(14)13-8-5(11)2-4(10)6(7(8)12)9(15)16/h2H,1H3,(H,13,14)(H,15,16) |
| InChIKey | GNOGSFBXBWBTIG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C(=C1I)C(=O)O)I)I |
| Reference | <p> |
