For research use only. Not for therapeutic Use.
Acetyl-13C2 Chloride is an isotopically labeled chemical compound featuring two carbon-13 atoms. This compound is highly valuable in research areas such as organic synthesis, mass spectrometry, and metabolic studies, where precise tracking of carbon atoms is essential. The 13C labeling allows for enhanced detection and quantification in analytical applications, particularly in studying reaction mechanisms, isotopic dilution assays, and metabolic pathways. Acetyl-13C2 Chloride is also used in the development of labeled pharmaceuticals and agrochemicals. Its high purity and reactivity ensure consistent performance across various experimental setups, making it a critical tool in cutting-edge scientific research.
CAS Number | 89186-79-8 |
Synonyms | Acetyl Chloride-1,2-13C2 |
Molecular Formula | C2H3ClO |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | acetyl chloride |
InChI | InChI=1S/C2H3ClO/c1-2(3)4/h1H3/i1+1,2+1 |
InChIKey | WETWJCDKMRHUPV-ZDOIIHCHSA-N |
SMILES | [13CH3][13C](=O)Cl |