For research use only. Not for therapeutic Use.
Acetylacetone (Cat.No:R022010)is a colorless or pale yellow liquid with a pungent odor. It is a versatile chemical compound widely used in various industrial applications, including as a solvent, a chemical intermediate, and a coordination ligand in the synthesis of metal complexes. Acetylacetone is known for its chelating properties and its role in forming stable metal chelates.
CAS Number | 123-54-6 |
Synonyms | ACAC; Acetoacetone; 2,4-Dioxopentane; 2,4-Pentadione; Acetyl-2-Propanone; Diacetylmethane; NSC 139614; NSC 2679; NSC 2927; NSC 52336; NSC 54069; NSC 5575; NSC 77075; NSC 78795; Pentan-2,4-dione |
Molecular Formula | C5H8O2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | pentane-2,4-dione |
InChI | InChI=1S/C5H8O2/c1-4(6)3-5(2)7/h3H2,1-2H3 |
InChIKey | YRKCREAYFQTBPV-UHFFFAOYSA-N |
SMILES | CC(=O)CC(=O)C |
Reference | <span style=”color:#000000;”><span style=”font-family:arial,helvetica,sans-serif;”><span style=”font-size:12px;”><span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”>1. Z. Anal. Chem. Fresenius 184, 255, (1961)<br /> |