For research use only. Not for therapeutic Use.
Acetylcysteine is a mucolytic agent and antioxidant commonly used in medical treatment to break down mucus in respiratory conditions such as chronic bronchitis, COPD, and cystic fibrosis. It acts by reducing the viscosity of mucus, facilitating easier clearance from the airways. Additionally, acetylcysteine is used as an antidote for acetaminophen overdose, helping replenish glutathione levels to detoxify the liver. Its antioxidant properties also make it valuable in reducing oxidative stress in various other medical and research applications.
| Catalog Number | A000591 |
| CAS Number | 616-91-1 |
| Synonyms | N-Acetyl-L-cysteine; N-Acetylcysteine. |
| Molecular Formula | C5H9NO3S |
| Purity | ≥95% |
| Target | NF-κB |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | 3 years -20 ℃ |
| IUPAC Name | (2R)-2-acetamido-3-sulfanylpropanoic acid |
| InChI | InChI=1S/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/t4-/m0/s1 |
| InChIKey | PWKSKIMOESPYIA-BYPYZUCNSA-N |
| SMILES | CC(=O)NC(CS)C(=O)O |
