For research use only. Not for therapeutic Use.
Acetylleucine（Cat No.:I005739）, is a synthetic compound used in pharmaceuticals. It is a derivative of the amino acid leucine, with an acetyl group attached to its structure. Acetylleucine has been explored for its potential therapeutic effects on various neurological disorders, particularly in treating vertigo and balance-related issues. This compound is believed to have a positive impact on the central nervous system, potentially improving symptoms associated with vestibular dysfunction.
| Catalog Number | I005739 |
| CAS Number | 99-15-0 |
| Molecular Formula | C8H15NO3 |
| Purity | ≥95% |
| Solubility | 10 mM in H2O |
| Storage | Room Temperature |
| IUPAC Name | 2-acetamido-4-methylpentanoic acid |
| InChI | InChI=1S/C8H15NO3/c1-5(2)4-7(8(11)12)9-6(3)10/h5,7H,4H2,1-3H3,(H,9,10)(H,11,12) |
| InChIKey | WXNXCEHXYPACJF-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)NC(=O)C |
