For research use only. Not for therapeutic Use.
Acetylpyrazine（Cat No.:I018307）, also known as 2-Acetylpyrazine, is a versatile compound that is often incorporated into various polycyclic structures. It finds utility in the pharmaceutical and perfume industries due to its ability to contribute desirable aromatic characteristics. Acetylpyrazine is also a component of folates, which are essential compounds belonging to the vitamin B group. These folates play vital roles in various biological processes, including DNA synthesis, cell division, and red blood cell production. The presence of acetylpyrazine in folates contributes to their overall structure and functionality.
| Catalog Number | I018307 |
| CAS Number | 22047-25-2 |
| Molecular Formula | C₆H₆N₂O |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | 1-pyrazin-2-ylethanone |
| InChI | InChI=1S/C6H6N2O/c1-5(9)6-4-7-2-3-8-6/h2-4H,1H3 |
| InChIKey | DBZAKQWXICEWNW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC=CN=C1 |
| Reference | [1]. Li MX, et al. Cytotoxicity and structure-activity relationships of four alpha-N-heterocyclic thiosemicarbazone derivatives crystal structure of 2-acetylpyrazine thiosemicarbazone. Bioorg Med Chem Lett. 2009 May 15;19(10):2704-6. |
