For research use only. Not for therapeutic Use.
Acetylsalicylic Acid-d4(Cat No.:R006562) is a high-purity, deuterated compound essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of acetylsalicylic acid, featuring four deuterium atoms, is crucial for studies on drug metabolism, pharmacokinetics, and NMR spectroscopy. The stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of experimental data. Ideal for various research applications, Acetylsalicylic Acid-d4 integrates seamlessly into existing protocols, providing a robust and cost-effective solution for high-precision scientific investigations and the development of innovative therapeutic agents.
Catalog Number | R006562 |
CAS Number | 97781-16-3 |
Synonyms | 2-Acetoxybenzoic-3,4,5,6-d4 Acid; Acetylsalicylic Acid-d4; Acylpyrin-d4; Angettes-d4; Aspro-d4; Aspirin-d4; |
Molecular Formula | C9H8O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-acetyloxy-3,4,5,6-tetradeuteriobenzoic acid |
InChI | InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)/i2D,3D,4D,5D |
InChIKey | BSYNRYMUTXBXSQ-QFFDRWTDSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)OC(=O)C)[2H])[2H] |