For research use only. Not for therapeutic Use.
Acetylshikonin (CAT: R072401) is a natural compound found in the roots of plants from the Lithospermum genus, particularly Lithospermum erythrorhizon. It is a member of the naphthoquinone family and is known for its various biological activities. Acetylshikonin has been studied for its potential pharmacological properties, including anti-inflammatory, antioxidant, and wound-healing effects. It is also used in traditional medicine systems for its therapeutic properties.
| Catalog Number | R072401 |
| CAS Number | 24502-78-1 |
| Molecular Formula | C18H18O6 |
| Purity | ≥95% |
| Target | Apoptosis |
| IUPAC Name | [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] acetate |
| InChI | InChI=1S/C18H18O6/c1-9(2)4-7-15(24-10(3)19)11-8-14(22)16-12(20)5-6-13(21)17(16)18(11)23/h4-6,8,15,20-21H,7H2,1-3H3/t15-/m1/s1 |
| InChIKey | WNFXUXZJJKTDOZ-OAHLLOKOSA-N |
| SMILES | CC(=CCC(C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O)OC(=O)C)C |
