For research use only. Not for therapeutic Use.
AChE-IN-27（Cat No.:I042886）is a novel acetylcholinesterase (AChE) inhibitor being studied for its potential in treating cognitive disorders, especially Alzheimer’s disease. By inhibiting AChE, it prevents the breakdown of acetylcholine, a neurotransmitter crucial for memory and cognitive functions. This leads to enhanced cholinergic activity, which may help improve symptoms like memory loss, confusion, and cognitive decline. AChE-IN-27 is under investigation for its ability to slow disease progression and provide therapeutic benefits in neurodegenerative conditions. Research is ongoing to evaluate its effectiveness, safety, and long-term impact on patients with Alzheimer’s.
| CAS Number | 177028-90-9 |
| Synonyms | 2-amino-4-(4-methylphenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| Molecular Formula | C20H14N2O3 |
| Purity | ≥95% |
| IUPAC Name | 2-amino-4-(4-methylphenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| InChI | InChI=1S/C20H14N2O3/c1-11-6-8-12(9-7-11)16-14(10-21)19(22)25-18-13-4-2-3-5-15(13)24-20(23)17(16)18/h2-9,16H,22H2,1H3 |
| InChIKey | VRDLSXTUIVLTTD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2C(=C(OC3=C2C(=O)OC4=CC=CC=C43)N)C#N |
