For research use only. Not for therapeutic Use.
Aciclovir (Cat No.: A001066) is an antiviral medication primarily used to treat infections caused by herpes viruses, including herpes simplex (cold sores, genital herpes) and varicella-zoster (shingles, chickenpox). It works by inhibiting the replication of viral DNA, thereby reducing the severity and duration of outbreaks. Aciclovir can be administered orally, topically, or intravenously, depending on the infection’s severity. Common side effects include nausea, diarrhea, and headaches, while severe reactions are rare. It’s generally well tolerated when used as prescribed.
| Catalog Number | A001066 |
| CAS Number | 59277-89-3 |
| Synonyms | Aciclovir; Acycloguanosine; 59277-89-3; Zovirax; Vipral |
| Molecular Formula | C8H11N5O3 |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | >11.4mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | 2-amino-9-(2-hydroxyethoxymethyl)-1H-purin-6-one |
| InChI | InChI=1S/C8H11N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) |
| InChIKey | MKUXAQIIEYXACX-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1COCCO)NC(=NC2=O)N |
