For research use only. Not for therapeutic Use.
Acid-PEG6-C2-Boc(Cat No.:I015967)is a compound used in chemical synthesis and drug development. It consists of a PEG (polyethylene glycol) linker, which is commonly used to enhance the solubility and stability of pharmaceutical compounds, attached to a C2 (two-carbon) chain and a Boc (tert-butoxycarbonyl) protecting group. The Boc group protects functional groups during synthesis, which can later be removed to reveal the active site of the molecule. Acid-PEG6-C2-Boc is useful in the synthesis of peptides, drug conjugates, and other biologically active molecules where controlled release or targeted delivery is required.
CAS Number | 2093153-84-3 |
Molecular Formula | C₂₀H₃₈O₁₀ |
Purity | ≥95% |
Target | PROTAC Linkers |
IUPAC Name | 3-[2-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
InChI | InChI=1S/C20H38O10/c1-20(2,3)30-19(23)5-7-25-9-11-27-13-15-29-17-16-28-14-12-26-10-8-24-6-4-18(21)22/h4-17H2,1-3H3,(H,21,22) |
InChIKey | HHEKCKLYBRNNLN-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCC(=O)O |