For research use only. Not for therapeutic Use.
Acitazanolast(Cat No.:M016772)is a selective inhibitor of phosphodiesterase 4 (PDE4), primarily investigated for its therapeutic potential in inflammatory and immunological disorders. By inhibiting PDE4, acitazanolast reduces the breakdown of cyclic AMP (cAMP), leading to decreased inflammatory mediator release. This compound has shown promise in treating conditions such as asthma, chronic obstructive pulmonary disease (COPD), and other autoimmune diseases by modulating immune responses and reducing inflammation. Ongoing research continues to explore its efficacy and safety in managing chronic inflammatory diseases, making it a potential breakthrough in immunomodulatory therapy.
CAS Number | 114607-46-4 |
Synonyms | 2-oxo-2-[3-(2H-tetrazol-5-yl)anilino]acetic acid |
Molecular Formula | C9H7N5O3 |
Purity | ≥95% |
IUPAC Name | 2-oxo-2-[3-(2H-tetrazol-5-yl)anilino]acetic acid |
InChI | InChI=1S/C9H7N5O3/c15-8(9(16)17)10-6-3-1-2-5(4-6)7-11-13-14-12-7/h1-4H,(H,10,15)(H,16,17)(H,11,12,13,14) |
InChIKey | VWQZJJZGISNFOE-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)NC(=O)C(=O)O)C2=NNN=N2 |