For research use only. Not for therapeutic Use.
Acoin（Cat No.:I021307）is a bioactive compound studied for its potential medicinal properties, particularly in the context of antimicrobial and anti-inflammatory activities. It is derived from certain natural sources, such as plants or fungi, and has demonstrated efficacy in inhibiting the growth of specific bacterial and fungal strains. Research on Acoin is ongoing, exploring its mechanisms of action and potential therapeutic uses, including the treatment of infections, inflammatory conditions, and possibly as an adjunct in cancer therapies. However, further clinical studies are needed to determine its safety, dosage, and overall therapeutic potential.
| Catalog Number | I021307 |
| CAS Number | 537-05-3 |
| Synonyms | Acoin; Acoin hydrochloride; Acoine |
| Molecular Formula | C23H26ClN3O3 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2-(4-ethoxyphenyl)-1,3-bis(4-methoxyphenyl)guanidine;hydrochloride |
| InChI | InChI=1S/C23H25N3O3.ClH/c1-4-29-22-15-9-19(10-16-22)26-23(24-17-5-11-20(27-2)12-6-17)25-18-7-13-21(28-3)14-8-18;/h5-16H,4H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | ZQWBGSZBBGYKNV-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)N=C(NC2=CC=C(C=C2)OC)NC3=CC=C(C=C3)OC.Cl |
| Reference | 1: Opperskalski J. [Results with the mucous membrane anesthetic Acoin in a urological practice]. Med Welt. 1965 Aug 14;33:1875-6. German. PubMed PMID: 5841665. |
