For research use only. Not for therapeutic Use.
Acridone-4-carboxylic acid（Cat No.:R071797）is an organic compound with a heterocyclic structure that includes an acridone ring system and a carboxyl group at the 4-position. It is studied for its potential biological activities, including anticancer, antimicrobial, and anti-inflammatory properties. This compound may act as a precursor or intermediate in the synthesis of more complex molecules used in drug development. Acridone derivatives are of particular interest in medicinal chemistry for their ability to interact with cellular targets, such as enzymes and receptors, making them candidates for therapeutic applications in various diseases.
| CAS Number | 24782-64-7 |
| Synonyms | 9-oxo-10H-acridine-4-carboxylic acid |
| Molecular Formula | C14H9NO3 |
| Purity | ≥95% |
| IUPAC Name | 9-oxo-10H-acridine-4-carboxylic acid |
| InChI | InChI=1S/C14H9NO3/c16-13-8-4-1-2-7-11(8)15-12-9(13)5-3-6-10(12)14(17)18/h1-7H,(H,15,16)(H,17,18) |
| InChIKey | BATAOFZEDHPRTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(N2)C(=CC=C3)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
