For research use only. Not for therapeutic Use.
Acrizanib(Cat No.:I000566)is a novel, selective inhibitor of vascular endothelial growth factor receptor 2 (VEGFR-2), playing a crucial role in angiogenesis and tumor growth. By blocking VEGFR-2 signaling, Acrizanib effectively inhibits the formation of new blood vessels that supply tumors, thereby restricting tumor growth and metastasis. Its specificity and potency make it a promising candidate for the treatment of various cancers, including those resistant to conventional therapies. Acrizanib’s targeted mechanism of action highlights its potential in developing more effective and less toxic cancer treatments, advancing oncology research and patient care.
CAS Number | 1229453-99-9 |
Synonyms | Acrizanib;5-({6-[(methylamino)methyl]pyrimidin-4-yl}oxy)-N-[1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-1H-indole-1-carboxamide |
Molecular Formula | C20H18F3N7O2 |
Purity | ≥95% |
Target | VEGFR |
Solubility | Soluble in DMSO |
Storage | 0 - 4°Cfor short term (days to weeks), or -20 °C for long term (months). |
IUPAC Name | 5-[6-(methylaminomethyl)pyrimidin-4-yl]oxy-N-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]indole-1-carboxamide |
InChI | InChI=1S/C20H18F3N7O2/c1-24-10-13-8-18(26-11-25-13)32-14-3-4-15-12(7-14)5-6-30(15)19(31)27-17-9-16(20(21,22)23)29(2)28-17/h3-9,11,24H,10H2,1-2H3,(H,27,28,31) |
InChIKey | XPIHPLVWOUDMPF-UHFFFAOYSA-N |
SMILES | CNCC1=CC(=NC=N1)OC2=CC3=C(C=C2)N(C=C3)C(=O)NC4=NN(C(=C4)C(F)(F)F)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |