Acrylamide-13C3（Cat No.:R058727） is a labeled isotopic form of acrylamide, a chemical compound commonly used in the production of polymers, as well as in laboratory and industrial applications. The “13C3” in its name indicates that three carbon atoms in the molecule are stable carbon-13 isotopes non-radioactive variants of carbon. This labeled form is often used in research studies involving metabolic pathways, toxicity, and other investigations where tracking the movement of carbon atoms is important.
| Catalog Number | R058727 |
| CAS Number | 287399-26-2 |
| Synonyms | 2-Propenamide-13C3; Acrylic Amide-13C3; Bio-Acrylamide 50-13C3; Ethylenecarboxamide; NSC 7785-13C3; Propenamide; Vinyl Amide-13C3; |
| Molecular Formula | C3H5NO |
| Purity | ≥95% |
| Storage | Store at +4°C |
| IUPAC Name | prop-2-enamide |
| InChI | InChI=1S/C3H5NO/c1-2-3(4)5/h2H,1H2,(H2,4,5)/i1+1,2+1,3+1 |
| InChIKey | HRPVXLWXLXDGHG-VMIGTVKRSA-N |
| SMILES | C=CC(=O)N |
