For research use only. Not for therapeutic Use.
ACT-335827（Cat No.:I011067）is an investigational small molecule being studied for its potential therapeutic applications, particularly in the treatment of metabolic and cardiovascular diseases. It is designed to modulate specific biological pathways, such as those involved in lipid metabolism or vascular function. By targeting key enzymes or receptors, ACT-335827 may help regulate cholesterol levels, improve endothelial function, and reduce inflammation. Research is ongoing to assess its efficacy, safety, and clinical potential, with a focus on addressing conditions such as dyslipidemia, atherosclerosis, and other cardiovascular-related disorders.
| CAS Number | 1354039-86-3 |
| Synonyms | (2R)-2-[(1S)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2-phenyl-N-propan-2-ylacetamide |
| Molecular Formula | C31H38N2O5 |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-[(1S)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2-phenyl-N-propan-2-ylacetamide |
| InChI | InChI=1S/C31H38N2O5/c1-20(2)32-31(34)30(22-10-8-7-9-11-22)33-15-14-23-18-28(37-5)29(38-6)19-24(23)25(33)16-21-12-13-26(35-3)27(17-21)36-4/h7-13,17-20,25,30H,14-16H2,1-6H3,(H,32,34)/t25-,30+/m0/s1 |
| InChIKey | HXHOBPVRRPCTLG-SETSBSEESA-N |
| SMILES | CC(C)NC(=O)[C@@H](C1=CC=CC=C1)N2CCC3=CC(=C(C=C3[C@@H]2CC4=CC(=C(C=C4)OC)OC)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
