For research use only. Not for therapeutic Use.
Acutumine(Cat No.:M083197) is a natural alkaloid extracted from the plant Sinomenium acutum, known for its distinctive scaffold that includes a tetrahydroisoquinoline connected to a cyclohexenone ring. This compound exhibits a range of biological activities; notably, it has shown promising anti-inflammatory and neuroprotective effects. Acutumine also displays potential antitumor properties, making it a compound of interest in cancer research.Its mechanism involves interacting with cellular enzymes and receptors, which could lead to new insights into cellular pathways and therapeutic strategies.
CAS Number | 17088-50-5 |
Molecular Formula | C19H24ClNO6 |
Purity | 98% |
Target | Plants |
Storage | Store at -20°C |
IUPAC Name | (1S,4'S,6S,10R,11S)-11-chloro-4'-hydroxy-3',4,5-trimethoxy-7-methylspiro[7-azatricyclo[4.3.3.01,6]dodec-4-ene-10,5'-cyclopent-2-ene]-1',3-dione |
InChI | InChI=1S/C19H24ClNO6/c1-21-6-5-17-8-10(22)14(26-3)16(27-4)18(17,21)9-12(20)19(17)13(23)7-11(25-2)15(19)24/h7,12,15,24H,5-6,8-9H2,1-4H3/t12-,15+,17+,18+,19+/m0/s1 |
InChIKey | FSXRARBVZZKCGJ-FMAJMWNWSA-N |
SMILES | CN1CCC23C1(CC(C24C(C(=CC4=O)OC)O)Cl)C(=C(C(=O)C3)OC)OC |