For research use only. Not for therapeutic Use.
Acyclovir N,O-Diacetate is a derivative of the antiviral drug Acyclovir, crucial for advanced pharmaceutical research. This compound is essential for studying the pharmacokinetics, metabolism, and therapeutic efficacy of Acyclovir. Its unique chemical structure allows for detailed analysis of drug delivery mechanisms and improved bioavailability. Acyclovir N,O-Diacetate is highly valued for its purity and stability, making it an indispensable tool in the development of effective treatments for viral infections, particularly herpes simplex and varicella-zoster viruses.
CAS Number | 75128-73-3 |
Synonyms | N-[9-[[2-(Acetyloxy)ethoxy]methyl]-6,9-dihydro-6-oxo-1H-purin-2-yl]acetamide; ?9-[(2-Acetoxyethoxy)methyl]-N2-acetylguanine; Diacetyl Acyclovir; ?N2-Acetyl-9-(2-acetoxyethoxymethyl)guanine; |
Molecular Formula | C12H15N5O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[(2-acetamido-6-oxo-3H-purin-9-yl)methoxy]ethyl acetate |
InChI | InChI=1S/C12H15N5O5/c1-7(18)14-12-15-10-9(11(20)16-12)13-5-17(10)6-21-3-4-22-8(2)19/h5H,3-4,6H2,1-2H3,(H2,14,15,16,18,20) |
InChIKey | VBHLKZHSCMQLTI-UHFFFAOYSA-N |
SMILES | CC(=O)NC1=NC(=O)C2=C(N1)N(C=N2)COCCOC(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |