For research use only. Not for therapeutic Use.
<span style="color:#000000;"><span style="font-size:12px;"><span style="font-family:arial,helvetica,sans-serif;">Adamantoic Acid(CAS 828-51-3) <span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">is a potent and reversible CerK inhibitor.</span><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">It can be used as a stabilizer in the synthesis of monodisperse, highly crystalline CoPt3 nanoparticles1 and porous platinum nanoparticles.</span></span></span></span>
| Catalog Number | R016633 |
| CAS Number | 828-51-3 |
| Synonyms | 1-Adamantanecarboxylic Acid; 1-Adamantane-1-carboxylic Acid; 1-Adamantylcarboxylic Acid; 1-Carboxyadamantane; NSC 94182; Tricyclo[3.3.1.13,7]decane-1-carboxylic Acid |
| Molecular Formula | C11H16O2 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | adamantane-1-carboxylic acid |
| InChI | InChI=1S/C11H16O2/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H,12,13) |
| InChIKey | JIMXXGFJRDUSRO-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)O |
| Reference | 1.<span style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Shevchenko, Elena V., et al. "Colloidal synthesis and self-assembly of CoPt3 nanocrystals." </span><i style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Journal of the American Chemical Society</i><span style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;"> 124.38 (2002): 11480-11485.<br /> |
