For research use only. Not for therapeutic Use.
Ademetionine(Cat No.:I003035), also known as S-adenosylmethionine (SAMe), is a naturally occurring compound found in the body, playing a crucial role in methylation processes and the synthesis of neurotransmitters. It is used therapeutically for its hepatoprotective, antidepressant, and anti-inflammatory properties. Ademetionine supports liver function by aiding in detoxification and regeneration, making it beneficial in treating liver diseases such as cirrhosis and hepatitis. Additionally, it has shown effectiveness in alleviating symptoms of depression and osteoarthritis. As a versatile compound, Ademetionine is valuable in promoting mental health and liver function.
CAS Number | 29908-03-0 |
Synonyms | S-adenosyl-L-methionine |
Molecular Formula | C15H22N6O5S |
Purity | 98% |
Documentation | |
Target | Apoptosis |
Solubility | H2O: > 45 mg/mL |
Storage | Store at RT |
IUPAC Name | (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylsulfonio]butanoate |
InChI | InChI=1S/C15H22N6O5S/c1-27(3-2-7(16)15(24)25)4-8-10(22)11(23)14(26-8)21-6-20-9-12(17)18-5-19-13(9)21/h5-8,10-11,14,22-23H,2-4,16H2,1H3,(H2-,17,18,19,24,25)/t7-,8+,10+,11+,14+,27?/m0/s1 |
InChIKey | MEFKEPWMEQBLKI-AIRLBKTGSA-N |
SMILES | C[S+](CCC(C(=O)[O-])N)CC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |