For research use only. Not for therapeutic Use.
Adenine-13C is a high-purity isotopically labeled compound crucial for advanced pharmaceutical and biochemical research. This version of Adenine incorporates carbon-13, making it essential for studies on nucleic acid metabolism, cellular processes, and genetic research. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of metabolic and pharmacokinetic studies. With improved stability and consistency, Adenine-13C integrates seamlessly into various experimental protocols, offering a robust and cost-effective solution for high-precision scientific investigations. Ideal for research and development, it supports the advancement of safer and more effective therapeutic agents.
| Catalog Number | S001045 |
| CAS Number | 86967-48-8 |
| Molecular Formula | C413CH5N5 |
| Purity | ≥95% |
| IUPAC Name | 7H-purin-6-amine |
| InChI | InChI=1S/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10)/i1+1 |
| InChIKey | GFFGJBXGBJISGV-OUBTZVSYSA-N |
| SMILES | C1=NC(=C2C(=N1)N=[13CH]N2)N |
