Adenine（Cat No.:A000924）is a fundamental nucleobase found in DNA and RNA, playing a crucial role in cellular energy transfer and genetic information encoding. As a component of ATP, NAD, and FAD, adenine is essential for various biochemical processes, including metabolism and enzyme reactions. It pairs with thymine in DNA and uracil in RNA, contributing to the stability of nucleic acid structures. Adenine’s role extends to its involvement in cellular signaling and regulation, making it indispensable for life. Its presence is vital for DNA replication, transcription, and cellular energy dynamics.
| Catalog Number | A000924 |
| CAS Number | 73-24-5 |
| Synonyms | NA |
| Molecular Formula | C5H5N5 |
| Purity | ≥95% |
| Target | Nucleoside Antimetabolite/Analogue |
| Solubility | Limited solubility |
| Storage | 3 years -20C powder |
| IUPAC Name | 7H-purin-6-amine |
| InChI | InChI=1S/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10) |
| InChIKey | GFFGJBXGBJISGV-UHFFFAOYSA-N |
| SMILES | C1=NC2=NC=NC(=C2N1)N |
