For research use only. Not for therapeutic Use.
Adenine hydrochloride (Cat. No: A000927) is a purine derivative, which has a variety of biochemical effects as a form of adenine hydrochloride.
| Catalog Number | A000927 |
| CAS Number | 2922-28-3 |
| Synonyms | NA |
| Molecular Formula | C5H6ClN5 |
| Purity | ≥95% |
| Target | Cell Cycle/DNA Damage |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | 3 years -20C powder |
| IUPAC Name | 7H-purin-6-amine;hydrochloride |
| InChI | InChI=1S/C5H5N5.ClH/c6-4-3-5(9-1-7-3)10-2-8-4;/h1-2H,(H3,6,7,8,9,10);1H |
| InChIKey | UQVDQSWZQXDUJB-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC=N2)N.Cl |
