Adenine Hydrochloride-15N5(Cat No.:C000023) is an isotopically labeled form of adenine hydrochloride, where all five nitrogen atoms are enriched with nitrogen-15 (15N). This enhancement allows for detailed tracking and analysis of adenine’s role in nucleic acid and energy metabolism studies using advanced spectroscopic techniques like NMR. As a fundamental component of DNA, RNA, and ATP, understanding adenine’s behavior and interactions at the molecular level is crucial. Adenine Hydrochloride-15N5 is particularly valuable for research in genetics, biochemistry, and molecular biology, providing insights into cellular processes and the basis of genetic information transfer.
Catalog Number | C000023 |
CAS Number | 2095709-78-5 |
Synonyms | Leucon-15N5, Adenine Monohydrochloride-15N5; 1H-Purin-6-amine Monohydrochloride-15N5; |
Molecular Formula | C₅H₅¹⁵N₅ • HCl |
Purity | 95% |
Solubility | DMSO (Slightly), Methanol (Slightly) |
Storage | 4°C, Hygroscopic |
IUPAC Name | 7H-purin-6-(15N)amine;hydrochloride |
InChI | InChI=1S/C5H5N5.ClH/c6-4-3-5(9-1-7-3)10-2-8-4;/h1-2H,(H3,6,7,8,9,10);1H/i6+1,7+1,8+1,9+1,10+1; |
InChIKey | UQVDQSWZQXDUJB-KBVYELETSA-N |
SMILES | C1=NC2=NC=NC(=C2N1)N.Cl |