For research use only. Not for therapeutic Use.
Adenine monohydrochloride hemihydrate（Cat No.:I010909） is an endogenous metabolite. Adenine hydrochloride is widely distributed in animal and plant tissues combined with nicotinamide, d-ribose and phosphoric acid; components of nucleic acids and coenzymes, such as enzymatic enzyme I and enzymatic enzyme II, adenylic acid, coal dehydrogenase. Mainly used for the determination of microbial niacin; in the study of genetics, viral diseases and cancer.
| Catalog Number | I010909 |
| CAS Number | 6055-72-7 |
| Synonyms | 6-Aminopurine hydrochloride |
| Molecular Formula | C5H8ClN5O |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Solubility | Soluble to 100 mM in water and to 100 mM in DMSO |
| Storage | Desiccate at RT |
| IUPAC Name | 7H-purin-6-amine;hydrate;hydrochloride |
| InChI | InChI=1S/C5H5N5.ClH.H2O/c6-4-3-5(9-1-7-3)10-2-8-4;;/h1-2H,(H3,6,7,8,9,10);1H;1H2 |
| InChIKey | MYRDTAUFFBYTHA-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC=N2)N.O.Cl |
