For research use only. Not for therapeutic Use.
Adenosine-¹³C（Cat No.:R041001）is an isotopically labeled nucleoside used in metabolic research, NMR spectroscopy, and biomolecular studies. As a ¹³C-labeled analog of adenosine, it enables precise tracking of nucleotide metabolism, RNA synthesis, and purine biosynthesis in biological systems. This compound is particularly valuable in stable isotope-resolved metabolomics (SIRM), enzyme mechanism studies, and pharmacokinetics, where labeled adenosine enhances mass spectrometry and nuclear magnetic resonance (NMR) analysis. It is widely applied in drug development, cancer research, and virology, contributing to the understanding of nucleoside analogs, ATP pathways, and therapeutic target interactions.
| CAS Number | 54447-57-3 |
| Synonyms | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxy(113C)methyl)oxolane-3,4-diol |
| Molecular Formula | C913CH13N5O4 |
| Purity | ≥95% |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxy(113C)methyl)oxolane-3,4-diol |
| InChI | InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1/i1+1 |
| InChIKey | OIRDTQYFTABQOQ-XUZOCFOZSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)[13CH2]O)O)O)N |
