Adenosine-13C5 is a stable isotope-labeled analog of adenosine, where five carbon atoms in the molecule are replaced with the carbon-13 isotope. This compound is widely used in metabolic research, particularly in studies involving nucleosides, nucleotides, and related biochemical pathways. The incorporation of carbon-13 allows for precise tracking and quantification of adenosine in metabolic flux analysis, mass spectrometry, and nuclear magnetic resonance (NMR) studies. Adenosine-13C5 is an essential tool for researchers exploring nucleotide metabolism, energy transfer, and the roles of adenosine in various physiological processes, providing enhanced sensitivity and accuracy in experimental data.
| Catalog Number | R050222 |
| CAS Number | 159496-13-6 |
| Synonyms | 9-β-D-Ribofuranosyl-9H-purin-6-amine-13C5; 9-β-D-Ribofuranosyladenine-13C5; Adenine Riboside-13C5; Adenocard-13C5; Adenocor-13C5; Adenogesic-13C5; Adenoscan-13C5; Adrekar-13C5; Boniton-13C5; D-Adenosine-13C5; 1-(6-Amino-9H-purin-9-yl)-1-deoxy-β-D-rib |
| Molecular Formula | C₅¹³C₅H₁₃N₅O₄ |
| Purity | 95% |
| Storage | Store at -20°C |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolane-3,4-diol |
| InChI | InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1/i1+1,4+1,6+1,7+1,10+1 |
| InChIKey | OIRDTQYFTABQOQ-ANYWVTQQSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[13C@H]3[13C@@H]([13C@@H]([13C@H](O3)[13CH2]O)O)O)N |
