For research use only. Not for therapeutic Use.
Adenosine 5’-Monophosphate Disodium Salt (Cat No.:R050972) is a biologically important compound essential for various cellular processes. Functioning as a nucleotide, it plays a key role in energy transfer and signal transduction within cells. Its mode of action involves participating in enzymatic reactions and serving as a precursor for adenosine triphosphate (ATP) synthesis. Pharmacologically, it holds significance as a biochemical research tool, aiding studies related to cellular metabolism, gene expression, and signaling pathways. Its applications range from molecular biology experiments to drug development research, contributing to our understanding of cellular functions and potentially guiding the discovery of new therapeutic interventions.
CAS Number | 4578-31-8 |
Synonyms | 5’-Adenylic Acid Sodium Salt; 5’-Adenylic Acid Disodium Salt; 5’-AMP Disodium Salt; AMP Disodium Salt; Adenosine 5’-phosphate Disodium Salt; Adenylic Acid Disodium Salt; Disodium 5’-AMP; Disodium 9-(β-D-Ribofuranosyl)adenine 5’-Monophosphate; Disodiu |
Molecular Formula | C10H12N5Na2O7P |
Purity | ≥95% |
Target | Adenosine Receptor |
Storage | Store at RT |
IUPAC Name | disodium;[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
InChI | InChI=1S/C10H14N5O7P.2Na/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20;;/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20);;/q;2*+1/p-2/t4-,6-,7-,10-;;/m1../s1 |
InChIKey | QGXLVXZRPRRCRP-IDIVVRGQSA-L |
SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)([O-])[O-])O)O)N.[Na+].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |