For research use only. Not for therapeutic Use.
Adenosine 5’-Monophosphate (AMP) is a nucleotide essential for cellular energy transfer and metabolism. It plays a crucial role in biochemical processes, including ATP synthesis and signal transduction pathways. Widely used in biochemical and pharmaceutical research, AMP is vital for studying cellular functions, enzyme activities, and metabolic pathways, ensuring precise and reliable experimental results.
CAS Number | 61-19-8 |
Synonyms | 5’-AMP; AMP; AMP (Nucleotide); Adenosine 5’-(Dihydrogen Phosphate); Adenosine 5’-monophosphate; Adenosine 5’-Phosphate; Adenosine 5’-Phosphoric Acid; Adenosine Monophosphate; Adenosine phosphate; Adenosine-5-monophosphoric Acid; Adenovite; Adenylic A |
Molecular Formula | C10H14N5O7P |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
InChI | InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
InChIKey | UDMBCSSLTHHNCD-KQYNXXCUSA-N |
SMILES | C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)O)O)O |