Adenosine amine congener (Cat No.:I017395) is a compound that acts as a selective agonist for the A1 adenosine receptor. It has been shown to have beneficial effects in the context of noise-induced and cisplatin-induced cochlear injury. By activating A1 adenosine receptors, ADAC can ameliorate cochlear damage caused by excessive noise exposure or cisplatin administration. Additionally, ADAC exhibits neuroprotective properties, providing protection against neuronal damage and promoting cell survival in various experimental models.
Catalog Number | I017395 |
CAS Number | 96760-69-9 |
Molecular Formula | C₂₈H₃₂N₈O₆ |
Purity | 95% |
Storage | Room Temperature |
IUPAC Name | N-(2-aminoethyl)-2-[4-[[2-[4-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]phenyl]acetyl]amino]phenyl]acetamide |
InChI | InChI=1S/C28H32N8O6/c29-9-10-30-21(38)11-16-1-5-18(6-2-16)34-22(39)12-17-3-7-19(8-4-17)35-26-23-27(32-14-31-26)36(15-33-23)28-25(41)24(40)20(13-37)42-28/h1-8,14-15,20,24-25,28,37,40-41H,9-13,29H2,(H,30,38)(H,34,39)(H,31,32,35)/t20-,24-,25-,28-/m1/s1 |
InChIKey | JFRJCQJVFMHZOO-QZHHGCDDSA-N |
SMILES | C1=CC(=CC=C1CC(=O)NC2=CC=C(C=C2)CC(=O)NCCN)NC3=C4C(=NC=N3)N(C=N4)C5C(C(C(O5)CO)O)O |
Reference | [1]. Vlajkovic SM, et al. Adenosine amine congener as a cochlear rescue agent. Biomed Res Int. 2014;2014:841489.<br>[2]. Vlajkovic SM, et al. Adenosine amine congener mitigates noise-induced cochlear injury. Purinergic Signal. 2010 Jun;6(2):273-81. |