For research use only. Not for therapeutic Use.
Adenylyl cyclase type 2 agonist-1(Cat No.:I043551)is a synthetic compound that selectively activates adenylyl cyclase type 2 (AC2), an enzyme responsible for converting ATP to cyclic AMP (cAMP), a key second messenger in cellular signaling. By stimulating AC2, this agonist enhances cAMP production, influencing various biological processes such as neurotransmission, hormone regulation, and immune responses. Research into AC2 agonists like this one aims to explore their potential therapeutic applications in diseases where cAMP signaling is disrupted, such as neurological disorders, cardiovascular diseases, and certain types of cancer.
CAS Number | 2414908-52-2 |
Synonyms | (1S,3aS,6aR)-5′-bromo-5-(2-chlorophenyl)-1-(4-methylphenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2′-indene]-1′,3′,4,6-tetrone |
Molecular Formula | C27H17BrClNO5 |
Purity | ≥95% |
IUPAC Name | (1S,3aS,6aR)-5'-bromo-5-(2-chlorophenyl)-1-(4-methylphenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
InChI | InChI=1S/C27H17BrClNO5/c1-13-6-8-14(9-7-13)22-20-21(26(34)30(25(20)33)19-5-3-2-4-18(19)29)27(35-22)23(31)16-11-10-15(28)12-17(16)24(27)32/h2-12,20-22H,1H3/t20-,21-,22-,27?/m1/s1 |
InChIKey | HVCLMGZGIMRDRV-LPOKKUQKSA-N |
SMILES | CC1=CC=C(C=C1)[C@@H]2[C@H]3[C@H](C(=O)N(C3=O)C4=CC=CC=C4Cl)C5(O2)C(=O)C6=C(C5=O)C=C(C=C6)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |