For research use only. Not for therapeutic Use.
Adibendan (Cat.No:M006640) is a cardiovascular drug with vasodilatory and positive inotropic effects. It enhances heart function by increasing contractility and dilating blood vessels, potentially benefiting heart failure patients. Adibendan’s mechanism involves inhibiting phosphodiesterase III, leading to increased cyclic AMP levels in cardiac cells. Clinical studies have explored its therapeutic potential.
Catalog Number | M006640 |
CAS Number | 100510-33-6 |
Molecular Formula | C16H14N4O |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 7,7-dimethyl-2-pyridin-4-yl-1,5-dihydropyrrolo[2,3-f]benzimidazol-6-one |
InChI | InChI=1S/C16H14N4O/c1-16(2)10-7-12-13(8-11(10)20-15(16)21)19-14(18-12)9-3-5-17-6-4-9/h3-8H,1-2H3,(H,18,19)(H,20,21) |
InChIKey | TVLQBBHUNDMTEC-UHFFFAOYSA-N |
SMILES | CC1(C2=CC3=C(C=C2NC1=O)N=C(N3)C4=CC=NC=C4)C |