For research use only. Not for therapeutic Use.
Adjudin（Cat No.:I002857）is a small molecule that acts as an inhibitor of Sertoli cell-germ cell interaction, specifically disrupting the function of tight junctions in the seminiferous epithelium. It has been studied for its potential as a male contraceptive by impairing spermatogenesis without affecting testosterone production. Adjudin works by selectively targeting and weakening the blood-testis barrier, preventing the proper development and maturation of sperm. Although promising in preclinical trials, its use as a contraceptive requires further research to determine safety, reversibility, and potential side effects before clinical application.
| Catalog Number | I002857 |
| CAS Number | 252025-52-8 |
| Molecular Formula | C15H12Cl2N4O |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | DMSO: ≥ 34 mg/mL |
| Storage | Store at -20C |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]indazole-3-carbohydrazide |
| InChI | InChI=1S/C15H12Cl2N4O/c16-10-6-5-9(12(17)7-10)8-21-13-4-2-1-3-11(13)14(20-21)15(22)19-18/h1-7H,8,18H2,(H,19,22) |
| InChIKey | VENCPJAAXKBIJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2CC3=C(C=C(C=C3)Cl)Cl)C(=O)NN |
